C20H24Cl4N2O6 — CID 70616535
acetic acid;2,4-dichloro-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol (PubChem CID 70616535) has the molecular formula C20H24Cl4N2O6 and a molecular weight of 530.23 g/mol. Its IUPAC name is acetic acid;2,4-dichloro-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol.
| Compound Name | acetic acid;2,4-dichloro-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 70616535 |
| Molecular Formula | C20H24Cl4N2O6 |
| Molecular Weight | 530.23 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | acetic acid;2,4-dichloro-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol |
| SMILES | CC(=O)O.CC(=O)O.Oc1c(Cl)cc(Cl)cc1CNCCNCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H16Cl4N2O2.2C2H4O2/c17-11-3-9(15(23)13(19)5-11)7-21-1-2-22-8-10-4-12(18)6-14(20)16(10)24;2*1-2(3)4/h3-6,21-24H,1-2,7-8H2;2*1H3,(H,3,4) |
| InChIKey | QPCWIKNUPFWRNV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|