C16H16Cl4N2O2 — CID 134097048
2,5-dichloro-3-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol (PubChem CID 134097048) has the molecular formula C16H16Cl4N2O2 and a molecular weight of 410.13 g/mol. Its IUPAC name is 2,5-dichloro-3-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol.
| Compound Name | 2,5-dichloro-3-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 134097048 |
| Molecular Formula | C16H16Cl4N2O2 |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 2,5-dichloro-3-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol |
| SMILES | Oc1cc(Cl)cc(CNCCNCc2cc(Cl)cc(Cl)c2O)c1Cl |
| InChI | InChI=1S/C16H16Cl4N2O2/c17-11-4-10(16(24)13(19)5-11)8-22-2-1-21-7-9-3-12(18)6-14(23)15(9)20/h3-6,21-24H,1-2,7-8H2 |
| InChIKey | SIFQKWUQJSWVHQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|