C13H13Cl2NOS — CID 54953211
2,4-dichloro-6-[(2-thiophen-3-ylethylamino)methyl]phenol (PubChem CID 54953211) has the molecular formula C13H13Cl2NOS and a molecular weight of 302.23 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2-thiophen-3-ylethylamino)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2-thiophen-3-ylethylamino)methyl]phenol |
|---|---|
| PubChem CID | 54953211 |
| Molecular Formula | C13H13Cl2NOS |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2,4-dichloro-6-[(2-thiophen-3-ylethylamino)methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1CNCCc1ccsc1 |
| InChI | InChI=1S/C13H13Cl2NOS/c14-11-5-10(13(17)12(15)6-11)7-16-3-1-9-2-4-18-8-9/h2,4-6,8,16-17H,1,3,7H2 |
| InChIKey | OTJJDFFDDULMSK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|