C13H13BrClNS — CID 66159781
N-[(2-bromo-5-chlorophenyl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 66159781) has the molecular formula C13H13BrClNS and a molecular weight of 330.68 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 66159781 |
| Molecular Formula | C13H13BrClNS |
| Molecular Weight | 330.68 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | Clc1ccc(Br)c(CNCCc2ccsc2)c1 |
| InChI | InChI=1S/C13H13BrClNS/c14-13-2-1-12(15)7-11(13)8-16-5-3-10-4-6-17-9-10/h1-2,4,6-7,9,16H,3,5,8H2 |
| InChIKey | CUYMUMOBMKDVQQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|