C13H14FNOS — CID 112606678
2-fluoro-6-[(2-thiophen-3-ylethylamino)methyl]phenol (PubChem CID 112606678) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-fluoro-6-[(2-thiophen-3-ylethylamino)methyl]phenol.
| Compound Name | 2-fluoro-6-[(2-thiophen-3-ylethylamino)methyl]phenol |
|---|---|
| PubChem CID | 112606678 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-fluoro-6-[(2-thiophen-3-ylethylamino)methyl]phenol |
| SMILES | Oc1c(F)cccc1CNCCc1ccsc1 |
| InChI | InChI=1S/C13H14FNOS/c14-12-3-1-2-11(13(12)16)8-15-6-4-10-5-7-17-9-10/h1-3,5,7,9,15-16H,4,6,8H2 |
| InChIKey | NNLBMVCSIDWTPL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|