C15H16ClNOS — CID 66391231
N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 66391231) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 66391231 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | Clc1ccc2c(c1)CC(CNCCc1ccsc1)O2 |
| InChI | InChI=1S/C15H16ClNOS/c16-13-1-2-15-12(7-13)8-14(18-15)9-17-5-3-11-4-6-19-10-11/h1-2,4,6-7,10,14,17H,3,5,8-9H2 |
| InChIKey | IZBFFJINSKAWBI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|