C17H17F2NO — CID 66365064
N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 66365064) has the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66365064 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | Fc1ccc(CCNCC2Cc3cc(F)ccc3O2)cc1 |
| InChI | InChI=1S/C17H17F2NO/c18-14-3-1-12(2-4-14)7-8-20-11-16-10-13-9-15(19)5-6-17(13)21-16/h1-6,9,16,20H,7-8,10-11H2 |
| InChIKey | NQJZFEFDQJFFFD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|