C15H18FN3O — CID 66365475
N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(1-methylimidazol-2-yl)ethanamine (PubChem CID 66365475) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(1-methylimidazol-2-yl)ethanamine.
| Compound Name | N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(1-methylimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 66365475 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(1-methylimidazol-2-yl)ethanamine |
| SMILES | Cn1ccnc1CCNCC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H18FN3O/c1-19-7-6-18-15(19)4-5-17-10-13-9-11-8-12(16)2-3-14(11)20-13/h2-3,6-8,13,17H,4-5,9-10H2,1H3 |
| InChIKey | YJVFSPQLNJLRQG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|