C18H26FNO — CID 66365861
N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-methylcyclohexyl)ethanamine (PubChem CID 66365861) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-methylcyclohexyl)ethanamine.
| Compound Name | N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-methylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 66365861 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-2-(4-methylcyclohexyl)ethanamine |
| SMILES | CC1CCC(CCNCC2Cc3cc(F)ccc3O2)CC1 |
| InChI | InChI=1S/C18H26FNO/c1-13-2-4-14(5-3-13)8-9-20-12-17-11-15-10-16(19)6-7-18(15)21-17/h6-7,10,13-14,17,20H,2-5,8-9,11-12H2,1H3 |
| InChIKey | BMBWCBNZIVCJBA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|