C15H21FN2O2 — CID 66365277
3-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-N-propylpropanamide (PubChem CID 66365277) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 3-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-N-propylpropanamide.
| Compound Name | 3-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 66365277 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNCC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H21FN2O2/c1-2-6-18-15(19)5-7-17-10-13-9-11-8-12(16)3-4-14(11)20-13/h3-4,8,13,17H,2,5-7,9-10H2,1H3,(H,18,19) |
| InChIKey | OFBDCAPCMYQPIT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|