About N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine
N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 113393694) has the molecular formula C12H12Br2N2S
and a molecular weight of 376.12 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine.
Molecular Properties
| Compound Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine |
| PubChem CID | 113393694 |
| Molecular Formula | C12H12Br2N2S |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | Brc1cnc(CNCCc2ccsc2)c(Br)c1 |
| InChI | InChI=1S/C12H12Br2N2S/c13-10-5-11(14)12(16-6-10)7-15-3-1-9-2-4-17-8-9/h2,4-6,8,15H,1,3,7H2 |
| InChIKey | HIBZENPXHKPONX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine?
The IUPAC name of N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine (CID 113393694) is N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine.
What is the SMILES notation for N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine?
The canonical SMILES for N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine is Brc1cnc(CNCCc2ccsc2)c(Br)c1.
What is the InChIKey of N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine?
The InChIKey is HIBZENPXHKPONX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Br2N2S/c13-10-5-11(14)12(16-6-10)7-15-3-1-9-2-4-17-8-9/h2,4-6,8,15H,1,3,7H2.
What are the key properties of N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine?
N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine has a molecular weight of 376.12 g/mol, XLogP of 4.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dibromo-2-pyridinyl)methyl]-2-thiophen-3-ylethanamine is sourced from PubChem (CID 113393694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).