C10H10Br2N4O — CID 114183499
N-[(3,5-dibromo-2-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 114183499) has the molecular formula C10H10Br2N4O and a molecular weight of 362.03 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 114183499 |
| Molecular Formula | C10H10Br2N4O |
| Molecular Weight | 362.03 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Brc1cnc(CNCCc2ncon2)c(Br)c1 |
| InChI | InChI=1S/C10H10Br2N4O/c11-7-3-8(12)9(14-4-7)5-13-2-1-10-15-6-17-16-10/h3-4,6,13H,1-2,5H2 |
| InChIKey | HTJPWCJFXDLONQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.03 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|