C9H13N5O — CID 106395888
N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 106395888) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 106395888 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Cc1[nH]cnc1CNCCc1ncon1 |
| InChI | InChI=1S/C9H13N5O/c1-7-8(12-5-11-7)4-10-3-2-9-13-6-15-14-9/h5-6,10H,2-4H2,1H3,(H,11,12) |
| InChIKey | RPRYHMHRWDAWCP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|