C12H18Br2N2O — CID 104573881
6-[(3,5-dibromo-2-pyridinyl)methylamino]hexan-1-ol (PubChem CID 104573881) has the molecular formula C12H18Br2N2O and a molecular weight of 366.10 g/mol. Its IUPAC name is 6-[(3,5-dibromo-2-pyridinyl)methylamino]hexan-1-ol.
| Compound Name | 6-[(3,5-dibromo-2-pyridinyl)methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 104573881 |
| Molecular Formula | C12H18Br2N2O |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 6-[(3,5-dibromo-2-pyridinyl)methylamino]hexan-1-ol |
| SMILES | OCCCCCCNCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H18Br2N2O/c13-10-7-11(14)12(16-8-10)9-15-5-3-1-2-4-6-17/h7-8,15,17H,1-6,9H2 |
| InChIKey | SUUBDZSLVFSMQM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|