C10H13Br2N3O2 — CID 106236398
2-[2-[(3,5-dibromo-2-pyridinyl)methylamino]ethoxy]acetamide (PubChem CID 106236398) has the molecular formula C10H13Br2N3O2 and a molecular weight of 367.04 g/mol. Its IUPAC name is 2-[2-[(3,5-dibromo-2-pyridinyl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3,5-dibromo-2-pyridinyl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106236398 |
| Molecular Formula | C10H13Br2N3O2 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 2-[2-[(3,5-dibromo-2-pyridinyl)methylamino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C10H13Br2N3O2/c11-7-3-8(12)9(15-4-7)5-14-1-2-17-6-10(13)16/h3-4,14H,1-2,5-6H2,(H2,13,16) |
| InChIKey | PVYZCSGJHMSXIG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|