C11H17N3O2 — CID 106238176
2-[2-[(3-methyl-2-pyridinyl)methylamino]ethoxy]acetamide (PubChem CID 106238176) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-[2-[(3-methyl-2-pyridinyl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-methyl-2-pyridinyl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106238176 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-[2-[(3-methyl-2-pyridinyl)methylamino]ethoxy]acetamide |
| SMILES | Cc1cccnc1CNCCOCC(N)=O |
| InChI | InChI=1S/C11H17N3O2/c1-9-3-2-4-14-10(9)7-13-5-6-16-8-11(12)15/h2-4,13H,5-8H2,1H3,(H2,12,15) |
| InChIKey | QYMNHHNAFNHDHI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|