C12H19BrN2 — CID 107320423
5-bromo-N-[(3-methyl-2-pyridinyl)methyl]pentan-1-amine (PubChem CID 107320423) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 5-bromo-N-[(3-methyl-2-pyridinyl)methyl]pentan-1-amine.
| Compound Name | 5-bromo-N-[(3-methyl-2-pyridinyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 107320423 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-bromo-N-[(3-methyl-2-pyridinyl)methyl]pentan-1-amine |
| SMILES | Cc1cccnc1CNCCCCCBr |
| InChI | InChI=1S/C12H19BrN2/c1-11-6-5-9-15-12(11)10-14-8-4-2-3-7-13/h5-6,9,14H,2-4,7-8,10H2,1H3 |
| InChIKey | ZUFYMDVHGDWWLD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|