C9H13Br2N3O2S — CID 102680182
2-[(3,5-dibromo-2-pyridinyl)methylamino]-N-methylethanesulfonamide (PubChem CID 102680182) has the molecular formula C9H13Br2N3O2S and a molecular weight of 387.10 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-pyridinyl)methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[(3,5-dibromo-2-pyridinyl)methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102680182 |
| Molecular Formula | C9H13Br2N3O2S |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 2-[(3,5-dibromo-2-pyridinyl)methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C9H13Br2N3O2S/c1-12-17(15,16)3-2-13-6-9-8(11)4-7(10)5-14-9/h4-5,12-13H,2-3,6H2,1H3 |
| InChIKey | GILSZURSLIFSGP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|