C6H4Br2FN — CID 149128897
3,5-dibromo-2-(fluoromethyl)pyridine (PubChem CID 149128897) has the molecular formula C6H4Br2FN and a molecular weight of 268.91 g/mol. Its IUPAC name is 3,5-dibromo-2-(fluoromethyl)pyridine.
| Compound Name | 3,5-dibromo-2-(fluoromethyl)pyridine |
|---|---|
| PubChem CID | 149128897 |
| Molecular Formula | C6H4Br2FN |
| Molecular Weight | 268.91 g/mol |
| Exact Mass | 266.87 |
| IUPAC Name | 3,5-dibromo-2-(fluoromethyl)pyridine |
| SMILES | FCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C6H4Br2FN/c7-4-1-5(8)6(2-9)10-3-4/h1,3H,2H2 |
| InChIKey | RBUTZEAKVXQYEF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |