C12H9Br2FN2 — CID 113393630
N-[(3,5-dibromo-2-pyridinyl)methyl]-3-fluoroaniline (PubChem CID 113393630) has the molecular formula C12H9Br2FN2 and a molecular weight of 360.02 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-pyridinyl)methyl]-3-fluoroaniline.
| Compound Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 113393630 |
| Molecular Formula | C12H9Br2FN2 |
| Molecular Weight | 360.02 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-3-fluoroaniline |
| SMILES | Fc1cccc(NCc2ncc(Br)cc2Br)c1 |
| InChI | InChI=1S/C12H9Br2FN2/c13-8-4-11(14)12(17-6-8)7-16-10-3-1-2-9(15)5-10/h1-6,16H,7H2 |
| InChIKey | KMIFKTISQRABOQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.02 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |