C8H8F3N — CID 60922269
N-(2,2-difluoroethyl)-3-fluoroaniline (PubChem CID 60922269) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-fluoroaniline.
| Compound Name | N-(2,2-difluoroethyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 60922269 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-fluoroaniline |
| SMILES | Fc1cccc(NCC(F)F)c1 |
| InChI | InChI=1S/C8H8F3N/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4,8,12H,5H2 |
| InChIKey | JYOFNVLAXWTXCV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |