C9H10ClF2N — CID 65023628
3-(chloromethyl)-N-(2,2-difluoroethyl)aniline (PubChem CID 65023628) has the molecular formula C9H10ClF2N and a molecular weight of 205.64 g/mol. Its IUPAC name is 3-(chloromethyl)-N-(2,2-difluoroethyl)aniline.
| Compound Name | 3-(chloromethyl)-N-(2,2-difluoroethyl)aniline |
|---|---|
| PubChem CID | 65023628 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 3-(chloromethyl)-N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1cccc(CCl)c1 |
| InChI | InChI=1S/C9H10ClF2N/c10-5-7-2-1-3-8(4-7)13-6-9(11)12/h1-4,9,13H,5-6H2 |
| InChIKey | BXACRIILBRTJHC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|