C9H11F2NO — CID 130693904
[3-(2,2-difluoroethylamino)phenyl]methanol (PubChem CID 130693904) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is [3-(2,2-difluoroethylamino)phenyl]methanol.
| Compound Name | [3-(2,2-difluoroethylamino)phenyl]methanol |
|---|---|
| PubChem CID | 130693904 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | [3-(2,2-difluoroethylamino)phenyl]methanol |
| SMILES | OCc1cccc(NCC(F)F)c1 |
| InChI | InChI=1S/C9H11F2NO/c10-9(11)5-12-8-3-1-2-7(4-8)6-13/h1-4,9,12-13H,5-6H2 |
| InChIKey | LTBXBVQGFXUVEZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |