C11H17NO4S — CID 175277279
4-[3-(hydroxymethyl)anilino]butane-1-sulfonic acid (PubChem CID 175277279) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)anilino]butane-1-sulfonic acid.
| Compound Name | 4-[3-(hydroxymethyl)anilino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 175277279 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-[3-(hydroxymethyl)anilino]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCNc1cccc(CO)c1 |
| InChI | InChI=1S/C11H17NO4S/c13-9-10-4-3-5-11(8-10)12-6-1-2-7-17(14,15)16/h3-5,8,12-13H,1-2,6-7,9H2,(H,14,15,16) |
| InChIKey | YEOYMRPBSMFUKX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|