C14H13F2NO2 — CID 79891427
2,6-difluoro-4-[[3-(hydroxymethyl)anilino]methyl]phenol (PubChem CID 79891427) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2,6-difluoro-4-[[3-(hydroxymethyl)anilino]methyl]phenol.
| Compound Name | 2,6-difluoro-4-[[3-(hydroxymethyl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 79891427 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2,6-difluoro-4-[[3-(hydroxymethyl)anilino]methyl]phenol |
| SMILES | OCc1cccc(NCc2cc(F)c(O)c(F)c2)c1 |
| InChI | InChI=1S/C14H13F2NO2/c15-12-5-10(6-13(16)14(12)19)7-17-11-3-1-2-9(4-11)8-18/h1-6,17-19H,7-8H2 |
| InChIKey | HUTNHDGERIAFMZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |