C15H11F2NO — CID 79887180
4-[(3-ethynylanilino)methyl]-2,6-difluorophenol (PubChem CID 79887180) has the molecular formula C15H11F2NO and a molecular weight of 259.25 g/mol. Its IUPAC name is 4-[(3-ethynylanilino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(3-ethynylanilino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79887180 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-[(3-ethynylanilino)methyl]-2,6-difluorophenol |
| SMILES | C#Cc1cccc(NCc2cc(F)c(O)c(F)c2)c1 |
| InChI | InChI=1S/C15H11F2NO/c1-2-10-4-3-5-12(6-10)18-9-11-7-13(16)15(19)14(17)8-11/h1,3-8,18-19H,9H2 |
| InChIKey | BUBARGARXXPNLD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|