C15H10F3N — CID 104854412
3-ethynyl-N-[(2,4,5-trifluorophenyl)methyl]aniline (PubChem CID 104854412) has the molecular formula C15H10F3N and a molecular weight of 261.25 g/mol. Its IUPAC name is 3-ethynyl-N-[(2,4,5-trifluorophenyl)methyl]aniline.
| Compound Name | 3-ethynyl-N-[(2,4,5-trifluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 104854412 |
| Molecular Formula | C15H10F3N |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-ethynyl-N-[(2,4,5-trifluorophenyl)methyl]aniline |
| SMILES | C#Cc1cccc(NCc2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C15H10F3N/c1-2-10-4-3-5-12(6-10)19-9-11-7-14(17)15(18)8-13(11)16/h1,3-8,19H,9H2 |
| InChIKey | ZWSWHUFYTBFKPY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|