C15H11Cl2N — CID 30055580
N-[(2,4-dichlorophenyl)methyl]-3-ethynylaniline (PubChem CID 30055580) has the molecular formula C15H11Cl2N and a molecular weight of 276.17 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-3-ethynylaniline.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-3-ethynylaniline |
|---|---|
| PubChem CID | 30055580 |
| Molecular Formula | C15H11Cl2N |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-3-ethynylaniline |
| SMILES | C#Cc1cccc(NCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N/c1-2-11-4-3-5-14(8-11)18-10-12-6-7-13(16)9-15(12)17/h1,3-9,18H,10H2 |
| InChIKey | BAPGUBGPILTTBG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|