C16H13Cl2N3 — CID 43739948
N-[(2,4-dichlorophenyl)methyl]-3-pyrazol-1-ylaniline (PubChem CID 43739948) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-3-pyrazol-1-ylaniline.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-3-pyrazol-1-ylaniline |
|---|---|
| PubChem CID | 43739948 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-3-pyrazol-1-ylaniline |
| SMILES | Clc1ccc(CNc2cccc(-n3cccn3)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3/c17-13-6-5-12(16(18)9-13)11-19-14-3-1-4-15(10-14)21-8-2-7-20-21/h1-10,19H,11H2 |
| InChIKey | SAJVNKKHPJSHFC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |