C14H11Cl2N5 — CID 43231375
N-[(2,4-dichlorophenyl)methyl]-3-(tetrazol-1-yl)aniline (PubChem CID 43231375) has the molecular formula C14H11Cl2N5 and a molecular weight of 320.18 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-3-(tetrazol-1-yl)aniline.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-3-(tetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 43231375 |
| Molecular Formula | C14H11Cl2N5 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-3-(tetrazol-1-yl)aniline |
| SMILES | Clc1ccc(CNc2cccc(-n3cnnn3)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N5/c15-11-5-4-10(14(16)6-11)8-17-12-2-1-3-13(7-12)21-9-18-19-20-21/h1-7,9,17H,8H2 |
| InChIKey | QCBPPJUSABVGAI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |