C16H13Cl2N5O2 — CID 2709053
N-[(2,4-dichlorophenyl)methyl]-2-[4-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 2709053) has the molecular formula C16H13Cl2N5O2 and a molecular weight of 378.22 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-[4-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 2709053 |
| Molecular Formula | C16H13Cl2N5O2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(-n2cnnn2)cc1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N5O2/c17-12-2-1-11(15(18)7-12)8-19-16(24)9-25-14-5-3-13(4-6-14)23-10-20-21-22-23/h1-7,10H,8-9H2,(H,19,24) |
| InChIKey | XURRRCINLVTZRF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |