C15H12Cl2N4O2 — CID 46814565
1-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]tetrazole (PubChem CID 46814565) has the molecular formula C15H12Cl2N4O2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]tetrazole.
| Compound Name | 1-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]tetrazole |
|---|---|
| PubChem CID | 46814565 |
| Molecular Formula | C15H12Cl2N4O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]tetrazole |
| SMILES | Clc1ccc(OCCOc2ccc(-n3cnnn3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N4O2/c16-11-1-6-15(14(17)9-11)23-8-7-22-13-4-2-12(3-5-13)21-10-18-19-20-21/h1-6,9-10H,7-8H2 |
| InChIKey | QNLXOCVPWQENLM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|