C16H12Cl2N4O2S — CID 7715845
2-(2,5-dichlorophenyl)sulfanylethyl 4-(tetrazol-1-yl)benzoate (PubChem CID 7715845) has the molecular formula C16H12Cl2N4O2S and a molecular weight of 395.27 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanylethyl 4-(tetrazol-1-yl)benzoate.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanylethyl 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 7715845 |
| Molecular Formula | C16H12Cl2N4O2S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanylethyl 4-(tetrazol-1-yl)benzoate |
| SMILES | O=C(OCCSc1cc(Cl)ccc1Cl)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H12Cl2N4O2S/c17-12-3-6-14(18)15(9-12)25-8-7-24-16(23)11-1-4-13(5-2-11)22-10-19-20-21-22/h1-6,9-10H,7-8H2 |
| InChIKey | QWZUZNLUCLKUQK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|