C17H12ClN5O2 — CID 17398436
5-(4-chlorophenyl)-2-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-oxazole (PubChem CID 17398436) has the molecular formula C17H12ClN5O2 and a molecular weight of 353.77 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-oxazole.
| Compound Name | 5-(4-chlorophenyl)-2-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 17398436 |
| Molecular Formula | C17H12ClN5O2 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[4-(tetrazol-1-yl)phenoxy]methyl]-1,3-oxazole |
| SMILES | Clc1ccc(-c2cnc(COc3ccc(-n4cnnn4)cc3)o2)cc1 |
| InChI | InChI=1S/C17H12ClN5O2/c18-13-3-1-12(2-4-13)16-9-19-17(25-16)10-24-15-7-5-14(6-8-15)23-11-20-21-22-23/h1-9,11H,10H2 |
| InChIKey | GJRKKPBGXUQQOP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |