C17H13ClN2O3 — CID 9356011
4-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methoxy]benzamide (PubChem CID 9356011) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methoxy]benzamide.
| Compound Name | 4-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 9356011 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCc2ncc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C17H13ClN2O3/c18-13-5-1-11(2-6-13)15-9-20-16(23-15)10-22-14-7-3-12(4-8-14)17(19)21/h1-9H,10H2,(H2,19,21) |
| InChIKey | JQWBMDQXMXHSQV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |