C17H11BrClNO4 — CID 30928179
[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 30928179) has the molecular formula C17H11BrClNO4 and a molecular weight of 408.64 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 30928179 |
| Molecular Formula | C17H11BrClNO4 |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)o1)OCc1ncc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H11BrClNO4/c18-15-7-5-13(23-15)6-8-17(21)22-10-16-20-9-14(24-16)11-1-3-12(19)4-2-11/h1-9H,10H2/b8-6+ |
| InChIKey | PHNWGXSLLXAVNW-SOFGYWHQSA-N |
| XLogP | 5.11 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|