C17H13NO3S — CID 71953934
(5-phenyl-1,3-oxazol-2-yl)methyl 3-thiophen-2-ylprop-2-enoate (PubChem CID 71953934) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 3-thiophen-2-ylprop-2-enoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 71953934 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(C=Cc1cccs1)OCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H13NO3S/c19-17(9-8-14-7-4-10-22-14)20-12-16-18-11-15(21-16)13-5-2-1-3-6-13/h1-11H,12H2 |
| InChIKey | VVLAMEKRTYTVAJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|