C24H19NO4 — CID 16500406
(5-phenyl-1,3-oxazol-2-yl)methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 16500406) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 16500406 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19NO4/c26-23(28-17-22-25-16-21(29-22)18-10-4-1-5-11-18)24(27,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-16,27H,17H2 |
| InChIKey | MQUOSZNFHWGYQZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |