C21H23NO3 — CID 8519620
(5-phenyl-1,3-oxazol-2-yl)methyl adamantane-2-carboxylate (PubChem CID 8519620) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl adamantane-2-carboxylate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519620 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl adamantane-2-carboxylate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H23NO3/c23-21(20-16-7-13-6-14(9-16)10-17(20)8-13)24-12-19-22-11-18(25-19)15-4-2-1-3-5-15/h1-5,11,13-14,16-17,20H,6-10,12H2 |
| InChIKey | QELPEJXMKLAWNF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |