C17H13NO4 — CID 7790163
(5-phenyl-1,3-oxazol-2-yl)methyl 3-hydroxybenzoate (PubChem CID 7790163) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 3-hydroxybenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7790163 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-hydroxybenzoate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)c1cccc(O)c1 |
| InChI | InChI=1S/C17H13NO4/c19-14-8-4-7-13(9-14)17(20)21-11-16-18-10-15(22-16)12-5-2-1-3-6-12/h1-10,19H,11H2 |
| InChIKey | NMYVBPQKSXTXAV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |