C15H12N2O6S — CID 47028405
(5-phenyl-1,3-oxazol-2-yl)methyl 5-sulfamoylfuran-2-carboxylate (PubChem CID 47028405) has the molecular formula C15H12N2O6S and a molecular weight of 348.34 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 5-sulfamoylfuran-2-carboxylate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 47028405 |
| Molecular Formula | C15H12N2O6S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 5-sulfamoylfuran-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)OCc2ncc(-c3ccccc3)o2)o1 |
| InChI | InChI=1S/C15H12N2O6S/c16-24(19,20)14-7-6-11(23-14)15(18)21-9-13-17-8-12(22-13)10-4-2-1-3-5-10/h1-8H,9H2,(H2,16,19,20) |
| InChIKey | SJTIXODBGZRVHU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |