C17H12INO3 — CID 8011127
(5-phenyl-1,3-oxazol-2-yl)methyl 3-iodobenzoate (PubChem CID 8011127) has the molecular formula C17H12INO3 and a molecular weight of 405.19 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 3-iodobenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-iodobenzoate |
|---|---|
| PubChem CID | 8011127 |
| Molecular Formula | C17H12INO3 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-iodobenzoate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)c1cccc(I)c1 |
| InChI | InChI=1S/C17H12INO3/c18-14-8-4-7-13(9-14)17(20)21-11-16-19-10-15(22-16)12-5-2-1-3-6-12/h1-10H,11H2 |
| InChIKey | GDSOGWLVKWSWOM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|