C20H18ClNO5 — CID 7654456
(5-phenyl-1,3-oxazol-2-yl)methyl 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7654456) has the molecular formula C20H18ClNO5 and a molecular weight of 387.82 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7654456 |
| Molecular Formula | C20H18ClNO5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCc2ncc(-c3ccccc3)o2)cc1OC |
| InChI | InChI=1S/C20H18ClNO5/c1-3-25-19-15(21)9-14(10-16(19)24-2)20(23)26-12-18-22-11-17(27-18)13-7-5-4-6-8-13/h4-11H,3,12H2,1-2H3 |
| InChIKey | CVOHZWYAJFWILQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |