C18H16ClNO4S — CID 7654293
1,3-benzothiazol-2-ylmethyl 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7654293) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7654293 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C18H16ClNO4S/c1-3-23-17-12(19)8-11(9-14(17)22-2)18(21)24-10-16-20-13-6-4-5-7-15(13)25-16/h4-9H,3,10H2,1-2H3 |
| InChIKey | IVVJGJRZABDHPR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |