C18H17BrN2O3S — CID 38283893
N-(1,3-benzothiazol-2-ylmethyl)-3-bromo-4-ethoxy-5-methoxybenzamide (PubChem CID 38283893) has the molecular formula C18H17BrN2O3S and a molecular weight of 421.32 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-bromo-4-ethoxy-5-methoxybenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-bromo-4-ethoxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 38283893 |
| Molecular Formula | C18H17BrN2O3S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-bromo-4-ethoxy-5-methoxybenzamide |
| SMILES | CCOc1c(Br)cc(C(=O)NCc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C18H17BrN2O3S/c1-3-24-17-12(19)8-11(9-14(17)23-2)18(22)20-10-16-21-13-6-4-5-7-15(13)25-16/h4-9H,3,10H2,1-2H3,(H,20,22) |
| InChIKey | INANDITZGFJYEN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |