C22H19N3O4S2 — CID 31101472
N-(1,3-benzothiazol-2-ylmethyl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 31101472) has the molecular formula C22H19N3O4S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 31101472 |
| Molecular Formula | C22H19N3O4S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(C(=O)NCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H19N3O4S2/c1-29-19-8-4-2-6-17(19)25-31(27,28)16-12-10-15(11-13-16)22(26)23-14-21-24-18-7-3-5-9-20(18)30-21/h2-13,25H,14H2,1H3,(H,23,26) |
| InChIKey | FBCXVEVASQPVGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |