C18H18N4O4S2 — CID 30580999
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 30580999) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 30580999 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | CCc1nnc(NC(=O)c2ccc(S(=O)(=O)Nc3ccccc3OC)cc2)s1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-3-16-20-21-18(27-16)19-17(23)12-8-10-13(11-9-12)28(24,25)22-14-6-4-5-7-15(14)26-2/h4-11,22H,3H2,1-2H3,(H,19,21,23) |
| InChIKey | IFEVBCCSPJCISS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |