C19H18N4O2S — CID 17311355
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-methylbenzoyl)amino]benzamide (PubChem CID 17311355) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-methylbenzoyl)amino]benzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 17311355 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(4-methylbenzoyl)amino]benzamide |
| SMILES | CCc1nnc(NC(=O)c2ccccc2NC(=O)c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C19H18N4O2S/c1-3-16-22-23-19(26-16)21-18(25)14-6-4-5-7-15(14)20-17(24)13-10-8-12(2)9-11-13/h4-11H,3H2,1-2H3,(H,20,24)(H,21,23,25) |
| InChIKey | GYMJOJHBIIFCNK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |