C12H13N3OS2 — CID 2475480
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methylsulfanylbenzamide (PubChem CID 2475480) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methylsulfanylbenzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 2475480 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methylsulfanylbenzamide |
| SMILES | CCc1nnc(NC(=O)c2ccccc2SC)s1 |
| InChI | InChI=1S/C12H13N3OS2/c1-3-10-14-15-12(18-10)13-11(16)8-6-4-5-7-9(8)17-2/h4-7H,3H2,1-2H3,(H,13,15,16) |
| InChIKey | KNOCFBKNQHXVOT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |