C16H20N4O2S — CID 17311855
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(3-methylbutanoylamino)benzamide (PubChem CID 17311855) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(3-methylbutanoylamino)benzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 17311855 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(3-methylbutanoylamino)benzamide |
| SMILES | CCc1nnc(NC(=O)c2ccccc2NC(=O)CC(C)C)s1 |
| InChI | InChI=1S/C16H20N4O2S/c1-4-14-19-20-16(23-14)18-15(22)11-7-5-6-8-12(11)17-13(21)9-10(2)3/h5-8,10H,4,9H2,1-3H3,(H,17,21)(H,18,20,22) |
| InChIKey | JKRTZGRNGCBISH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |